Weak base

From Wikipedia, the free encyclopedia
Jump to navigation Jump to search

A weak base is a base that, upon dissolution in water, does not dissociate completely, so that the resulting aqueous solution contains only a small proportion of hydroxide ions and the concerned basic radical, and a large proportion of undissociated molecules of the base.

pH, Kb, and Kw

[edit | edit source]

Bases yield solutions in which the hydrogen ion activity is lower than it is in pure water, i.e., the solution is said to have a pH greater than 7.0 at standard conditions, potentially as high as 14 (and even greater than 14 for some bases). The formula for pH is:

pH=log10[H+]

Bases are proton acceptors; a base will receive a hydrogen ion from water, H2O, and the remaining H+ concentration in the solution determines pH. A weak base will have a higher H+ concentration than a stronger base because it is less completely protonated than a stronger base and, therefore, more hydrogen ions remain in its solution. Given its greater H+ concentration, the formula yields a lower pH value for the weak base. However, pH of bases is usually calculated in terms of the OH concentration. This is done because the H+ concentration is not a part of the reaction, whereas the OH concentration is. The pOH is defined as:

pOH=log10[OH]

If we multiply the equilibrium constants of a conjugate acid (such as NH4+) and a conjugate base (such as NH3) we obtain:

Ka×Kb=[H3O+][NH3][NH4+]×[NH4+][OH][NH3]=[H3O+][OH]

As Kw=[H3O+][OH] is just the self-ionization constant of water, we have Ka×Kb=Kw

Taking the logarithm of both sides of the equation yields:

logKa+logKb=logKw

Finally, multiplying both sides by -1, we obtain:

pKa+pKb=pKw=14.00

With pOH obtained from the pOH formula given above, the pH of the base can then be calculated from pH=pKwpOH, where pKw = 14.00.

A weak base persists in chemical equilibrium in much the same way as a weak acid does, with a base dissociation constant (Kb) indicating the strength of the base. For example, when ammonia is put in water, the following equilibrium is set up:

Kb=[NH4+][OH][NH3]

A base that has a large Kb will ionize more completely and is thus a stronger base. As shown above, the pH of the solution, which depends on the H+ concentration, increases with increasing OH concentration; a greater OH concentration means a smaller H+ concentration, therefore a greater pH. Strong bases have smaller H+ concentrations because they are more fully protonated, leaving fewer hydrogen ions in the solution. A smaller H+ concentration means a greater OH concentration and, therefore, a greater Kb and a greater pH.

NaOH (s) (sodium hydroxide) is a stronger base than (CH3CH2)2NH (l) (diethylamine) which is a stronger base than NH3 (g) (ammonia). As the bases get weaker, the smaller the Kb values become.[1]

Percentage protonated

[edit | edit source]

As seen above, the strength of a base depends primarily on pH. To help describe the strengths of weak bases, it is helpful to know the percentage protonated-the percentage of base molecules that have been protonated. A lower percentage will correspond with a lower pH because both numbers result from the amount of protonation. A weak base is less protonated, leading to a lower pH and a lower percentage protonated.[2]

The typical proton transfer equilibrium appears as such:

B(aq)+H2O(l)HB+(aq)+OH(aq)

B represents the base.

Percentage protonated=molarity of HB+ initial molarity of B×100%=[HB+][B]initial×100%

In this formula, [B]initial is the initial molar concentration of the base, assuming that no protonation has occurred.

A typical pH problem

[edit | edit source]

Calculate the pH and percentage protonation of a .20 M aqueous solution of pyridine, C5H5N. The Kb for C5H5N is 1.8 x 10−9.[3]

First, write the proton transfer equilibrium:

H2O(l)+C5H5N(aq)C5H5NH+(aq)+OH(aq)
Kb=[C5H5NH+][OH][C5H5N]

The equilibrium table, with all concentrations in moles per liter, is

C5H5N C5H6N+ OH
initial normality .20 0 0
change in normality -x +x +x
equilibrium normality .20 -x x x
Substitute the equilibrium molarities into the basicity constant Kb=1.8×109=x×x.20x
We can assume that x is so small that it will be meaningless by the time we use significant figures. 1.8×109x2.20
Solve for x. x.20×(1.8×109)=1.9×105
Check the assumption that x << .20 1.9×105.20; so the approximation is valid
Find pOH from pOH = -log [OH] with [OH]=x pOHlog(1.9×105)=4.7
From pH = pKw - pOH, pH14.004.7=9.3
From the equation for percentage protonated with [HB+] = x and [B]initial = .20, percentage protonated=1.9×105.20×100%=.0095%

This means .0095% of the pyridine is in the protonated form of C5H5NH+.

Examples

[edit | edit source]

Simple Facts

[edit | edit source]
  • An example of a weak base is ammonia. It does not contain hydroxide ions, but it reacts with water to produce ammonium ions and hydroxide ions.[4]
  • The position of equilibrium varies from base to base when a weak base reacts with water. The further to the left it is, the weaker the base.[5]
  • When there is a hydrogen ion gradient between two sides of the biological membrane, the concentration of some weak bases are focused on only one side of the membrane.[6] Weak bases tend to build up in acidic fluids.[6] Acid gastric contains a higher concentration of weak base than plasma.[6] Acid urine, compared to alkaline urine, excretes weak bases at a faster rate.[6]

See also

[edit | edit source]

References

[edit | edit source]
  1. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  2. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  3. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  4. ^ Atkins, Peter, and Loretta Jones. Chemical Principles: The Quest for Insight, 3rd Ed., New York: W.H. Freeman, 2005.
  5. ^ Clark, Jim. "Strong and Weak Bases."N.p.,2002. Web.
  6. ^ a b c d Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
[edit | edit source]