Indanol

Indanol
Identifiers
CAS Number	1: 6351-10-6 racemic; 2: 4254-29-9; 4: 1641-41-4; 5: 1470-94-6;
3D model (JSmol)	1: Interactive image; 2: Interactive image; 4: Interactive image; 5: Interactive image;
Beilstein Reference	1:2042960,
ChEBI	1: CHEBI:16697; 5: CHEBI:59311;
ChEMBL	1: ChEMBL4564909; 5: ChEMBL3218378;
ChemSpider	1: 21394; 2: 70326; 4: 66840; 5: 14390;
ECHA InfoCard	Lua error in Module:Wikidata at line 880: attempt to index field 'wikibase' (a nil value). Lua error in Module:Wikidata at line 880: attempt to index field 'wikibase' (a nil value).Lua error in Module:EditAtWikidata at line 29: attempt to index field 'wikibase' (a nil value).
EC Number	1: 228-755-3; 2: 224-230-8; 4: 216-691-9; 5: 216-006-3;
E number	Lua error in Module:Wikidata at line 880: attempt to index field 'wikibase' (a nil value).
KEGG	1: C01710;
PubChem CID	1: 22819; 2: 77936; 4: 74233; 5: 15118;
UNII	1: LHG5BD7LOR; 2: B77NA7SM29; 4: 7PJT17BE05; 5: 9Z94H6F15T;
CompTox Dashboard (EPA)	{{#property:P3117}}Lua error in Module:EditAtWikidata at line 29: attempt to index field 'wikibase' (a nil value).; 4: DTXSID00167708; 5: DTXSID0051732;
	InChI 1: InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2 Key: YIAPLDFPUUJILH-UHFFFAOYSA-N; 2: InChI=1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2 Key: KMGCKSAIIHOKCX-UHFFFAOYSA-N; 4: InChI=1S/C9H10O/c10-9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2 Key: DPHNJPUOMLRELT-UHFFFAOYSA-N; 5: InChI=1S/C9H10O/c10-9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3H2 Key: PEHSSTUGJUBZBI-UHFFFAOYSA-N;
	SMILES 1: OC1CCc2ccccc21; 2: OC1Cc2ccccc2C1; 4: Oc1cccc2c1CCC2; 5: Oc1ccc2c(c1)CCC2;
Properties
Chemical formula	C9H10O
Molar mass	134.178 g·mol−1
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Indanols are a class of organic compounds, some of which are useful in medicine or industry. They are hydroxy derivatives of the parent compound called indane (also known as indan).

Isomers

1-indanol (racemic), m.p. 54.8; R enantiomer, m.p. 67-68°C

1-indanol (racemic), m.p. 54.8; R enantiomer, m.p. 67-68°C
2-indanol, m.p. 68-69 °C

2-indanol, m.p. 68-69 °C
4-indanol, m.p. 42 °C

4-indanol, m.p. 42 °C
5-indanol, m.p. 58 °C

5-indanol, m.p. 58 °C

Five isomers are possible, two of which are phenols (4- and 5-indanols). Three isomers feature hydroxyl group on the five-membered ring, including an enantiomeric pair of 1-indanol. 1-Indanol can be produced by reduction of 1-indanone.^[1] 5-indanol can be prepared by sulfonation of indane, following by base cleavage of the indane-5-sulfonate.^[2]

References

^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).

[1] Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).

[2] Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).

[1]

[2]

Identifiers
CAS Number	1: 6351-10-6 racemic 2: 4254-29-9 4: 1641-41-4 5: 1470-94-6
3D model (JSmol)	1: Interactive image 2: Interactive image 4: Interactive image 5: Interactive image
Beilstein Reference	1:2042960,
ChEBI	1: CHEBI:16697 5: CHEBI:59311
ChEMBL	1: ChEMBL4564909 5: ChEMBL3218378
ChemSpider	1: 21394 2: 70326 4: 66840 5: 14390
ECHA InfoCard	Lua error in Module:Wikidata at line 880: attempt to index field 'wikibase' (a nil value). Lua error in Module:Wikidata at line 880: attempt to index field 'wikibase' (a nil value).Lua error in Module:EditAtWikidata at line 29: attempt to index field 'wikibase' (a nil value).
EC Number	1: 228-755-3 2: 224-230-8 4: 216-691-9 5: 216-006-3
E number	Lua error in Module:Wikidata at line 880: attempt to index field 'wikibase' (a nil value).
KEGG	1: C01710
PubChem CID	1: 22819 2: 77936 4: 74233 5: 15118
UNII	1: LHG5BD7LOR 2: B77NA7SM29 4: 7PJT17BE05 5: 9Z94H6F15T
CompTox Dashboard (EPA)	{{#property:P3117}}Lua error in Module:EditAtWikidata at line 29: attempt to index field 'wikibase' (a nil value). 4: DTXSID00167708 5: DTXSID0051732
InChI 1: InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2 Key: YIAPLDFPUUJILH-UHFFFAOYSA-N 2: InChI=1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2 Key: KMGCKSAIIHOKCX-UHFFFAOYSA-N 4: InChI=1S/C9H10O/c10-9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2 Key: DPHNJPUOMLRELT-UHFFFAOYSA-N 5: InChI=1S/C9H10O/c10-9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3H2 Key: PEHSSTUGJUBZBI-UHFFFAOYSA-N
SMILES 1: OC1CCc2ccccc21 2: OC1Cc2ccccc2C1 4: Oc1cccc2c1CCC2 5: Oc1ccc2c(c1)CCC2
Properties
Chemical formula	C₉H₁₀O
Molar mass	134.178 g·mol⁻¹
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Indanol

Isomers

References

Navigation menu

Search