Achilleol A

Achilleol A

File:Achilleol A.svg
Names
IUPAC name (1S,3R)-2,2-dimethyl-4-methylidene-3-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]cyclohexan-1-ol
Identifiers
CAS Number	125287-06-1
3D model (JSmol)	Interactive image
ChEBI	CHEBI:189410
ChEMBL	ChEMBL1977780
ChemSpider	4581493
ECHA InfoCard
E number
PubChem CID	5471312
CompTox Dashboard (EPA)	{{#property:P3117}}
InChI InChI=1S/C30H50O/c1-23(2)13-11-16-25(4)18-12-17-24(3)14-9-10-15-26(5)19-21-28-27(6)20-22-29(31)30(28,7)8/h13-15,18,28-29,31H,6,9-12,16-17,19-22H2,1-5,7-8H3/b24-14+,25-18+,26-15+/t28-,29+/m1/s1 Key: ANKPMKKGZZQDIC-HJSIMFEZSA-N
SMILES CC(=CCC/C(=C/CC/C(=C/CC/C=C(\C)/CC[C@@H]1C(=C)CC[C@@H](C1(C)C)O)/C)/C)C
Properties
Chemical formula	C30H50O
Molar mass	426.729 g·mol−1
Density	g/cm3
Melting point	116 °C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Achilleol A is a monocyclic triterpene with the molecular formula C₃₀H₅₀O.

Natural occurrence

The compound is found in such taxons as Achillea odorata, Camellia oleifera, Santolina elegans, Triticum aestivum, among others.

Synthesis

There is a simple method for synthesizing the monocyclic triterpene achilleol A, employing titanium(III) chemistry as the crucial step. This synthesis validates the structure previously determined by spectroscopic analysis.