Phosphate phosphite

From Wikipedia, the free encyclopedia
Jump to navigation Jump to search

A phosphate phosphite is a chemical compound or salt that contains both phosphate and phosphite anions (PO3−4 and PO3−3). These are mixed anion compounds or mixed valence compounds. Some have third anions.

Phosphate phosphites frequently occur as metal organic framework (MOF) compounds which are of research interest for gas storage, detection or catalysis. In these phosphate and phosphite form bridging ligands to hard metal ions. Protonated amines are templates.[1]

Naming

[edit | edit source]

A phosphate phosphite compound may also be called a phosphite phosphate.

Production

[edit | edit source]

Phosphate phosphite compounds are frequently produced by hydrothermal synthesis, in which a water solution of ingredients is enclosed in a sealed container and heated. Phosphate may be reduced to phosphite or phosphite oxidised to phosphate in this process.

Properties

[edit | edit source]

On heating,

[edit | edit source]

Related to these are the nitrite nitrates and arsenate arsenites.

List

[edit | edit source]
name formula ratio PO4:PO3 mw system space group unit cell (Å) volume density properties references
1,4-Diammoniumbutane [(H3N(CH2)4NH3)2][Sc5F4(HPO3)6(H2PO3)2(PO4)] 1:8 1300.8 monoclinic C2/m a = 12.888,
b = 14.835,
c = 10.531,
β = 103.093°,
Z = 2 (at 93 K) 		1961.2 [2]
Imidazole [C3N2H5]2[VIII
4(H2O)3(HPO3)4(HPO4)3] 		3:4 1003.766 trigonal P3c1 a = 13.499,
c = 18.120,
Z = 12 		2280.35 2.143 green [3]
(C3H10NO)6[V8(H2O)6(PO4)2(HPO3)12] 2:12 P3c1 a = 13.5393,
c = 18.2283 		2893.8 green [4]
(C4H8N2)3[V8(H2O)6(PO4)2(HPO3)12] 2:12 P3c1 a = 13.4922,
c = 18.3589 		2894.3 green [4]
Mn5(μ-OH2)2(PO4)2(HPO3)2·2H2O 2:2 [5]
Iron(III) 2,2′-bipyridine phosphite−phposphate [FeIII(2,2′-bipyridine)(HPO3)(H2PO4)] 1:1 monoclinic a = 10.5407,
b = 6.4298,
c = 10.6172,
β = 113.890°,
Z = 2 		1.878 colourless [6]
FeIII(1,10-phenanthroline)(HPO3)(H2PO3) 1:1 monoclinic P21/m a = 10.180,
b = 6.424,
c = 11.6668,
β = 115.59°,
Z = 4 		668.2 1.880 yellow [7]
{[C3H4N2]2[C5NH5]14[H15(Mo2O4)8Co16(PO4)14(HPO3)10(OH)3]}·5H2O 14:10 6685.09 monoclinic C2/m a = 29.724,
b = 24.623,
c = 20.687,
β = 126.760°,
Z = 2 		12130 1.830 red [8]
Tris(4-pyridyl)triazine zinc phosphate–phosphite C54H60N18O42P10Zn9 ? 2531.23 hexagonal P63 a = 15.6464,
c = 19.788,
Z = 2 		4195.2 yellow [9]
1-(2-Aminoethyl)piperazine tetrazinc diphosphate diphosphite (C6H17N3)[Zn4(PO4)2(HPO3)2] 2:2 monoclinic Cc a = 5.327,
b = 17.146,
c = 22.071,
β = 94.58°,
Z = 4 		2009.5 [10]
Zinc phosphate-phosphite trans-(C6H15N2)2Zn4(PO4)2(HPO3)2 2:2 841.78 monoclinic P21/n a = 9.706,
b = 9.993,
c = 27.557,
β = 96.795°,
Z = 4 		2654.0 2.107 [11]
1,3-Cyclohexanebis(methylamine) [H2CHBMA][Zn1.5Mn(HPO3)2.5(PO4)]·5H2O 1:5 monoclinic C2/c a = 33.929,
b = 13.045,
c = 8.971,
β = 104.37°,
Z = 2 		3846.5 [12]
2-Hydroxypropylammonium dizinc hydrogenphosphite phosphate [C3H6(OH)NH3][Zn2(HPO3)(PO4)] 1:1 triclinic P1 a = 5.302,
b = 8.934,
c = 12.686,
α = 74.35°,
β = 88.54°,
γ = 73.94° 		[13]

(Bis(Cyclohexane-1,3-bis(methylammonium)) bis(μ4-phosphato)-tetrakis(μ3-hydrogen phosphito)-manganese-tetra-zinc dihydrate)

[H2CHBMA][Zn2Mn0.5(PO4)(HPO3)2]·H2O 1:2 monoclinic C2/c a = 33.929,
b = 13.045,
c = 8.971,
β = 104.37°,
Z = 4 		3846 [14]
Triethylenetetramine [C6N4H22]0.5[Zn3(PO4)2(HPO3)] 2:1 [15]
Zinc potassium phosphite phosphate [16]
N,N,N′,N′-tetramethylenediamine (TMEDA) (C6N2H18)2(C6N2H17)Ga15(OH)8(PO4)2(HPO4)12(HPO3)6·2H2O 14:6 P3 a = 19.046,
c = 8.331,
Z = 1 		2617.1 [17]
Zirconium phosphate phosphite γ-ZrPO4·HPO2(OH)·2H2O 1:1 layered [18]
Cadmium 1,10-phenanthroline phosphate phosphite oxalate Cd2(phen)2(H2PO4)(H2PO3)(C2O4) 1:1 chains [19]
catena-(Tris(hexane-1,6-diaminium) octakis(μ3-phosphonato)-hexakis(μ3-phosphato)-tris(μ2-hydrogen phosphato)hexaaqua-nonaindium [In9(H2O)6(HPO3)13(H2PO3)2(PO4)(HPO4)][(C6N2H18)3] 2:15 hexagonal P63/m a = 13.7676,
c = 28.062 		[20]
4-Bipyridine (C10H10N2)1.5(H3O)3[In18(H2O)12(HPO4)12(HPO3)16(H2PO3)6] 12:16 hexagonal P63/m a = 13.784,
c = 28.058 		4617 [21]
catena-(Bis(propane-1,3-diammonium)-octakis(μ3-phosphito)-pentakis(μ2-hydrogen phosphito)-(μ2-dihydrogenphosphato)-hexaindium) [In6(HPO3)8(H2PO3)5(H2PO4)]·(C3N2H12)2 1:11 orthorhombic Pna21 a = 26.7974,
b = 9.8459,
c = 18.5441,
Z = 4 		4892.8 [22]
Pb2Al(HPO3)3(H2PO4) 1:3 orthorhombic Cmcm [23]
Pb2Ga(HPO3)3(H2PO4) 1:3 orthorhombic Cmcm
Pb2Al(HPO3)2(HPO4)(H2PO4) 2:2 orthorhombic Cmcm
Rubidium uranium(VI,IV) phosphate-phosphite Rb2[(UO2)2(UIV)(PO4)2(HPO3)2(H2O)] 2:2 1316.94 monoclinic C2/c a = 16.2421,
b = 10.5049,
c = 11.0936,
β = 98.745° 		1870.8 4.702 orange-yellow [24]
Caesium uranium(IV) phosphate-phosphite Cs2[UIV
3(PO4)2(HPO3)4] 		2:4 1489.76 monoclinic C2/m a = 25.7396
b = 5.5906,
c = 7.6334,
β = 98.964°,
Z = 2 		1085.03 4.560 blue-green [24]
Caesium uranium(VI,IV) phosphate-phosphite Cs2[(UO2)(UIV)(HPO4)2(HPO3)2] 2:2 1123.78 triclinic P1 a = 6.8571,
b = 11.1190,
c = 12.0391,
α = 63.861°,
β = 77.481°,
γ = 79.331°,
Z = 2 		800.22 4.664 yellow-orange [24]
Cs4[(UO2)8(HPO4)5(HPO3)5]·4H2O 5:5 monoclinic C2/c a = 18.5005,
b = 10.971,
c = 14.4752,
β = 104.513° 		yellow [25]
Cs4[UIV
6(PO4)8(HPO4)(HPO3)] 		9:1 orthorhombic Pmmn a = 6.9321,
b = 26.935,
c = 10.9137 		pale green [25]
Cs10[UIV
10(PO4)4(HPO4)14(HPO3)5]·H2O 		15:5 monoclinic C2/m a = 19.2966,
b = 20.2914,
c = 13.9293,
β = 126.839° 		green [25]
Tl3[(UO2)2(H1.5PO4)(H0.5PO4)(H1.5PO3)2] 2:2 1503.07 tetragonal P42/mbc a = 13.5382,
c = 19.4008,
Z = 8 		3555.8 5.615 yellow-green [26]
Tl2[(UO2)2(UIV)(H2O)(PO4)2(HPO3)2] 2:2 1550.71 monoclinic C2/c a = 16.2360,
b = 10.4995,
c = 11.0003,
β = 99.027°,
Z = 4 		1851.99 5.562 light green [26]

References

[edit | edit source]
  1. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  2. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  3. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  4. ^ a b Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  5. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  6. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  7. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  8. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  9. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  10. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  11. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  12. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  13. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  14. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  15. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  16. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  17. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  18. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  19. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  20. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  21. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  22. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  23. ^ Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  24. ^ a b c Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  25. ^ a b c Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
  26. ^ a b Lua error in Module:Citation/CS1/Configuration at line 2172: attempt to index field '?' (a nil value).
Retrieved from "http://70.231.62.181/index.php?title=Phosphate_phosphite&oldid=6816286"